C15H27F3IN3O — CID 119134073
1-(1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)-2-methyl-3-(3,3,3-trifluoro-2-hydroxypropyl)guanidine;hydroiodide (PubChem CID 119134073) has the molecular formula C15H27F3IN3O and a molecular weight of 449.30 g/mol. Its IUPAC name is 1-(1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)-2-methyl-3-(3,3,3-trifluoro-2-hydroxypropyl)guanidine;hydroiodide.
| Compound Name | 1-(1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)-2-methyl-3-(3,3,3-trifluoro-2-hydroxypropyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 119134073 |
| Molecular Formula | C15H27F3IN3O |
| Molecular Weight | 449.30 g/mol |
| Exact Mass | 449.12 |
| IUPAC Name | 1-(1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)-2-methyl-3-(3,3,3-trifluoro-2-hydroxypropyl)guanidine;hydroiodide |
| SMILES | C/N=C(\NCC(O)C(F)(F)F)NC1CCC2CCCCC2C1.I |
| InChI | InChI=1S/C15H26F3N3O.HI/c1-19-14(20-9-13(22)15(16,17)18)21-12-7-6-10-4-2-3-5-11(10)8-12;/h10-13,22H,2-9H2,1H3,(H2,19,20,21);1H |
| InChIKey | NHQFTVGQMVBAHR-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 56.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.30 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|