C17H33IN4O2S — CID 119134151
1-(1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)-3-[2-(1,1-dioxo-1,2-thiazolidin-2-yl)ethyl]-2-methylguanidine;hydroiodide (PubChem CID 119134151) has the molecular formula C17H33IN4O2S and a molecular weight of 484.45 g/mol. Its IUPAC name is 1-(1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)-3-[2-(1,1-dioxo-1,2-thiazolidin-2-yl)ethyl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-(1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)-3-[2-(1,1-dioxo-1,2-thiazolidin-2-yl)ethyl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 119134151 |
| Molecular Formula | C17H33IN4O2S |
| Molecular Weight | 484.45 g/mol |
| Exact Mass | 484.14 |
| IUPAC Name | 1-(1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)-3-[2-(1,1-dioxo-1,2-thiazolidin-2-yl)ethyl]-2-methylguanidine;hydroiodide |
| SMILES | C/N=C(\NCCN1CCCS1(=O)=O)NC1CCC2CCCCC2C1.I |
| InChI | InChI=1S/C17H32N4O2S.HI/c1-18-17(19-9-11-21-10-4-12-24(21,22)23)20-16-8-7-14-5-2-3-6-15(14)13-16;/h14-16H,2-13H2,1H3,(H2,18,19,20);1H |
| InChIKey | KHKQVUMGTBFJKD-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.45 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|