C16H33N5O2S — CID 111371245
1-[2-(1,1-dioxo-1,2-thiazolidin-2-yl)ethyl]-2-methyl-3-[3-(2-methylpiperidin-1-yl)propyl]guanidine (PubChem CID 111371245) has the molecular formula C16H33N5O2S and a molecular weight of 359.54 g/mol. Its IUPAC name is 1-[2-(1,1-dioxo-1,2-thiazolidin-2-yl)ethyl]-2-methyl-3-[3-(2-methylpiperidin-1-yl)propyl]guanidine.
| Compound Name | 1-[2-(1,1-dioxo-1,2-thiazolidin-2-yl)ethyl]-2-methyl-3-[3-(2-methylpiperidin-1-yl)propyl]guanidine |
|---|---|
| PubChem CID | 111371245 |
| Molecular Formula | C16H33N5O2S |
| Molecular Weight | 359.54 g/mol |
| Exact Mass | 359.24 |
| IUPAC Name | 1-[2-(1,1-dioxo-1,2-thiazolidin-2-yl)ethyl]-2-methyl-3-[3-(2-methylpiperidin-1-yl)propyl]guanidine |
| SMILES | C/N=C(/NCCCN1CCCCC1C)NCCN1CCCS1(=O)=O |
| InChI | InChI=1S/C16H33N5O2S/c1-15-7-3-4-10-20(15)11-5-8-18-16(17-2)19-9-13-21-12-6-14-24(21,22)23/h15H,3-14H2,1-2H3,(H2,17,18,19) |
| InChIKey | OSLCRNHEWKOPNO-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 77.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.54 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|