C15H31N5O4S — CID 111887529
tert-butyl N-[3-[[N-[2-(1,1-dioxo-1,2-thiazolidin-2-yl)ethyl]-N'-methylcarbamimidoyl]amino]propyl]carbamate (PubChem CID 111887529) has the molecular formula C15H31N5O4S and a molecular weight of 377.51 g/mol. Its IUPAC name is tert-butyl N-[3-[[N-[2-(1,1-dioxo-1,2-thiazolidin-2-yl)ethyl]-N'-methylcarbamimidoyl]amino]propyl]carbamate.
| Compound Name | tert-butyl N-[3-[[N-[2-(1,1-dioxo-1,2-thiazolidin-2-yl)ethyl]-N'-methylcarbamimidoyl]amino]propyl]carbamate |
|---|---|
| PubChem CID | 111887529 |
| Molecular Formula | C15H31N5O4S |
| Molecular Weight | 377.51 g/mol |
| Exact Mass | 377.21 |
| IUPAC Name | tert-butyl N-[3-[[N-[2-(1,1-dioxo-1,2-thiazolidin-2-yl)ethyl]-N'-methylcarbamimidoyl]amino]propyl]carbamate |
| SMILES | C/N=C(\NCCCNC(=O)OC(C)(C)C)NCCN1CCCS1(=O)=O |
| InChI | InChI=1S/C15H31N5O4S/c1-15(2,3)24-14(21)19-8-5-7-17-13(16-4)18-9-11-20-10-6-12-25(20,22)23/h5-12H2,1-4H3,(H,19,21)(H2,16,17,18) |
| InChIKey | WKPSZTGCYVAOBM-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 112.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.51 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|