C10H22N4O2S2 — CID 111345687
1-[2-(1,1-dioxo-1,2-thiazolidin-2-yl)ethyl]-2-methyl-3-(2-methylsulfanylethyl)guanidine (PubChem CID 111345687) has the molecular formula C10H22N4O2S2 and a molecular weight of 294.45 g/mol. Its IUPAC name is 1-[2-(1,1-dioxo-1,2-thiazolidin-2-yl)ethyl]-2-methyl-3-(2-methylsulfanylethyl)guanidine.
| Compound Name | 1-[2-(1,1-dioxo-1,2-thiazolidin-2-yl)ethyl]-2-methyl-3-(2-methylsulfanylethyl)guanidine |
|---|---|
| PubChem CID | 111345687 |
| Molecular Formula | C10H22N4O2S2 |
| Molecular Weight | 294.45 g/mol |
| Exact Mass | 294.12 |
| IUPAC Name | 1-[2-(1,1-dioxo-1,2-thiazolidin-2-yl)ethyl]-2-methyl-3-(2-methylsulfanylethyl)guanidine |
| SMILES | C/N=C(\NCCSC)NCCN1CCCS1(=O)=O |
| InChI | InChI=1S/C10H22N4O2S2/c1-11-10(13-5-8-17-2)12-4-7-14-6-3-9-18(14,15)16/h3-9H2,1-2H3,(H2,11,12,13) |
| InChIKey | PSFLCJLQYOVNHA-UHFFFAOYSA-N |
| XLogP | -0.45 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.45 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|