C15H25IN4O3S — CID 111005488
1-[2-(1,1-dioxo-1,2-thiazolidin-2-yl)ethyl]-2-methyl-3-(2-phenoxyethyl)guanidine;hydroiodide (PubChem CID 111005488) has the molecular formula C15H25IN4O3S and a molecular weight of 468.36 g/mol. Its IUPAC name is 1-[2-(1,1-dioxo-1,2-thiazolidin-2-yl)ethyl]-2-methyl-3-(2-phenoxyethyl)guanidine;hydroiodide.
| Compound Name | 1-[2-(1,1-dioxo-1,2-thiazolidin-2-yl)ethyl]-2-methyl-3-(2-phenoxyethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111005488 |
| Molecular Formula | C15H25IN4O3S |
| Molecular Weight | 468.36 g/mol |
| Exact Mass | 468.07 |
| IUPAC Name | 1-[2-(1,1-dioxo-1,2-thiazolidin-2-yl)ethyl]-2-methyl-3-(2-phenoxyethyl)guanidine;hydroiodide |
| SMILES | C/N=C(/NCCOc1ccccc1)NCCN1CCCS1(=O)=O.I |
| InChI | InChI=1S/C15H24N4O3S.HI/c1-16-15(17-8-11-19-10-5-13-23(19,20)21)18-9-12-22-14-6-3-2-4-7-14;/h2-4,6-7H,5,8-13H2,1H3,(H2,16,17,18);1H |
| InChIKey | QDMUKNCLMAEJSH-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 83.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.36 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|