C13H29IN4O2S2 — CID 111629443
1-[2-(1,1-dioxo-1,2-thiazolidin-2-yl)ethyl]-3-ethyl-2-(4-methylsulfanylbutyl)guanidine;hydroiodide (PubChem CID 111629443) has the molecular formula C13H29IN4O2S2 and a molecular weight of 464.44 g/mol. Its IUPAC name is 1-[2-(1,1-dioxo-1,2-thiazolidin-2-yl)ethyl]-3-ethyl-2-(4-methylsulfanylbutyl)guanidine;hydroiodide.
| Compound Name | 1-[2-(1,1-dioxo-1,2-thiazolidin-2-yl)ethyl]-3-ethyl-2-(4-methylsulfanylbutyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111629443 |
| Molecular Formula | C13H29IN4O2S2 |
| Molecular Weight | 464.44 g/mol |
| Exact Mass | 464.08 |
| IUPAC Name | 1-[2-(1,1-dioxo-1,2-thiazolidin-2-yl)ethyl]-3-ethyl-2-(4-methylsulfanylbutyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\CCCCSC)NCCN1CCCS1(=O)=O.I |
| InChI | InChI=1S/C13H28N4O2S2.HI/c1-3-14-13(15-7-4-5-11-20-2)16-8-10-17-9-6-12-21(17,18)19;/h3-12H2,1-2H3,(H2,14,15,16);1H |
| InChIKey | FEHPEGKXTRWZQQ-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.44 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|