C17H35IN4O3S — CID 111576452
1-(2-cycloheptyloxyethyl)-2-[2-(1,1-dioxo-1,2-thiazolidin-2-yl)ethyl]-3-ethylguanidine;hydroiodide (PubChem CID 111576452) has the molecular formula C17H35IN4O3S and a molecular weight of 502.46 g/mol. Its IUPAC name is 1-(2-cycloheptyloxyethyl)-2-[2-(1,1-dioxo-1,2-thiazolidin-2-yl)ethyl]-3-ethylguanidine;hydroiodide.
| Compound Name | 1-(2-cycloheptyloxyethyl)-2-[2-(1,1-dioxo-1,2-thiazolidin-2-yl)ethyl]-3-ethylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111576452 |
| Molecular Formula | C17H35IN4O3S |
| Molecular Weight | 502.46 g/mol |
| Exact Mass | 502.15 |
| IUPAC Name | 1-(2-cycloheptyloxyethyl)-2-[2-(1,1-dioxo-1,2-thiazolidin-2-yl)ethyl]-3-ethylguanidine;hydroiodide |
| SMILES | CCN/C(=N\CCN1CCCS1(=O)=O)NCCOC1CCCCCC1.I |
| InChI | InChI=1S/C17H34N4O3S.HI/c1-2-18-17(19-10-13-21-12-7-15-25(21,22)23)20-11-14-24-16-8-5-3-4-6-9-16;/h16H,2-15H2,1H3,(H2,18,19,20);1H |
| InChIKey | YJOHGWDYHKKUDI-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 83.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.46 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|