C17H25N7 — CID 109405609
2-methyl-1-[2-(3-methyl-4-pyridinyl)ethyl]-3-(2-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl)guanidine (PubChem CID 109405609) has the molecular formula C17H25N7 and a molecular weight of 327.44 g/mol. Its IUPAC name is 2-methyl-1-[2-(3-methyl-4-pyridinyl)ethyl]-3-(2-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl)guanidine.
| Compound Name | 2-methyl-1-[2-(3-methyl-4-pyridinyl)ethyl]-3-(2-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl)guanidine |
|---|---|
| PubChem CID | 109405609 |
| Molecular Formula | C17H25N7 |
| Molecular Weight | 327.44 g/mol |
| Exact Mass | 327.22 |
| IUPAC Name | 2-methyl-1-[2-(3-methyl-4-pyridinyl)ethyl]-3-(2-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl)guanidine |
| SMILES | C/N=C(\NCCc1ccncc1C)NC1CCc2nc(C)nn2C1 |
| InChI | InChI=1S/C17H25N7/c1-12-10-19-8-6-14(12)7-9-20-17(18-3)22-15-4-5-16-21-13(2)23-24(16)11-15/h6,8,10,15H,4-5,7,9,11H2,1-3H3,(H2,18,20,22) |
| InChIKey | VNMRBXGPTBQTEY-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 80.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.44 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|