C17H28N4S — CID 109406376
1-(3-ethylsulfanylcyclopentyl)-2-methyl-3-[2-(3-methyl-4-pyridinyl)ethyl]guanidine (PubChem CID 109406376) has the molecular formula C17H28N4S and a molecular weight of 320.51 g/mol. Its IUPAC name is 1-(3-ethylsulfanylcyclopentyl)-2-methyl-3-[2-(3-methyl-4-pyridinyl)ethyl]guanidine.
| Compound Name | 1-(3-ethylsulfanylcyclopentyl)-2-methyl-3-[2-(3-methyl-4-pyridinyl)ethyl]guanidine |
|---|---|
| PubChem CID | 109406376 |
| Molecular Formula | C17H28N4S |
| Molecular Weight | 320.51 g/mol |
| Exact Mass | 320.20 |
| IUPAC Name | 1-(3-ethylsulfanylcyclopentyl)-2-methyl-3-[2-(3-methyl-4-pyridinyl)ethyl]guanidine |
| SMILES | CCSC1CCC(N/C(=N/C)NCCc2ccncc2C)C1 |
| InChI | InChI=1S/C17H28N4S/c1-4-22-16-6-5-15(11-16)21-17(18-3)20-10-8-14-7-9-19-12-13(14)2/h7,9,12,15-16H,4-6,8,10-11H2,1-3H3,(H2,18,20,21) |
| InChIKey | FIUZTXXFUCEPES-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 49.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.51 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|