C17H23ClF2N4O3 — CID 111994011
methyl 4-[[N-[[5-chloro-2-(difluoromethoxy)phenyl]methyl]-N'-methylcarbamimidoyl]amino]piperidine-1-carboxylate (PubChem CID 111994011) has the molecular formula C17H23ClF2N4O3 and a molecular weight of 404.85 g/mol. Its IUPAC name is methyl 4-[[N-[[5-chloro-2-(difluoromethoxy)phenyl]methyl]-N'-methylcarbamimidoyl]amino]piperidine-1-carboxylate.
| Compound Name | methyl 4-[[N-[[5-chloro-2-(difluoromethoxy)phenyl]methyl]-N'-methylcarbamimidoyl]amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 111994011 |
| Molecular Formula | C17H23ClF2N4O3 |
| Molecular Weight | 404.85 g/mol |
| Exact Mass | 404.14 |
| IUPAC Name | methyl 4-[[N-[[5-chloro-2-(difluoromethoxy)phenyl]methyl]-N'-methylcarbamimidoyl]amino]piperidine-1-carboxylate |
| SMILES | C/N=C(\NCc1cc(Cl)ccc1OC(F)F)NC1CCN(C(=O)OC)CC1 |
| InChI | InChI=1S/C17H23ClF2N4O3/c1-21-16(23-13-5-7-24(8-6-13)17(25)26-2)22-10-11-9-12(18)3-4-14(11)27-15(19)20/h3-4,9,13,15H,5-8,10H2,1-2H3,(H2,21,22,23) |
| InChIKey | WBBQISMEEFPUHR-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.85 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|