C18H28ClIN4O3 — CID 111838334
ethyl 4-[[N-[(4-chloro-2-methoxyphenyl)methyl]-N'-methylcarbamimidoyl]amino]piperidine-1-carboxylate;hydroiodide (PubChem CID 111838334) has the molecular formula C18H28ClIN4O3 and a molecular weight of 510.80 g/mol. Its IUPAC name is ethyl 4-[[N-[(4-chloro-2-methoxyphenyl)methyl]-N'-methylcarbamimidoyl]amino]piperidine-1-carboxylate;hydroiodide.
| Compound Name | ethyl 4-[[N-[(4-chloro-2-methoxyphenyl)methyl]-N'-methylcarbamimidoyl]amino]piperidine-1-carboxylate;hydroiodide |
|---|---|
| PubChem CID | 111838334 |
| Molecular Formula | C18H28ClIN4O3 |
| Molecular Weight | 510.80 g/mol |
| Exact Mass | 510.09 |
| IUPAC Name | ethyl 4-[[N-[(4-chloro-2-methoxyphenyl)methyl]-N'-methylcarbamimidoyl]amino]piperidine-1-carboxylate;hydroiodide |
| SMILES | CCOC(=O)N1CCC(N/C(=N/C)NCc2ccc(Cl)cc2OC)CC1.I |
| InChI | InChI=1S/C18H27ClN4O3.HI/c1-4-26-18(24)23-9-7-15(8-10-23)22-17(20-2)21-12-13-5-6-14(19)11-16(13)25-3;/h5-6,11,15H,4,7-10,12H2,1-3H3,(H2,20,21,22);1H |
| InChIKey | QAWGGYHNJKZEAB-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.80 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|