C19H28Cl2N4O3 — CID 111328158
ethyl 4-[[N-[3-(2,4-dichlorophenoxy)propyl]-N'-methylcarbamimidoyl]amino]piperidine-1-carboxylate (PubChem CID 111328158) has the molecular formula C19H28Cl2N4O3 and a molecular weight of 431.36 g/mol. Its IUPAC name is ethyl 4-[[N-[3-(2,4-dichlorophenoxy)propyl]-N'-methylcarbamimidoyl]amino]piperidine-1-carboxylate.
| Compound Name | ethyl 4-[[N-[3-(2,4-dichlorophenoxy)propyl]-N'-methylcarbamimidoyl]amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 111328158 |
| Molecular Formula | C19H28Cl2N4O3 |
| Molecular Weight | 431.36 g/mol |
| Exact Mass | 430.15 |
| IUPAC Name | ethyl 4-[[N-[3-(2,4-dichlorophenoxy)propyl]-N'-methylcarbamimidoyl]amino]piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(N/C(=N/C)NCCCOc2ccc(Cl)cc2Cl)CC1 |
| InChI | InChI=1S/C19H28Cl2N4O3/c1-3-27-19(26)25-10-7-15(8-11-25)24-18(22-2)23-9-4-12-28-17-6-5-14(20)13-16(17)21/h5-6,13,15H,3-4,7-12H2,1-2H3,(H2,22,23,24) |
| InChIKey | QETIFEFFDAYDSR-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.36 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|