C17H29IN4O3 — CID 111796057
ethyl 4-[[N-[(2,5-dimethylfuran-3-yl)methyl]-N'-methylcarbamimidoyl]amino]piperidine-1-carboxylate;hydroiodide (PubChem CID 111796057) has the molecular formula C17H29IN4O3 and a molecular weight of 464.35 g/mol. Its IUPAC name is ethyl 4-[[N-[(2,5-dimethylfuran-3-yl)methyl]-N'-methylcarbamimidoyl]amino]piperidine-1-carboxylate;hydroiodide.
| Compound Name | ethyl 4-[[N-[(2,5-dimethylfuran-3-yl)methyl]-N'-methylcarbamimidoyl]amino]piperidine-1-carboxylate;hydroiodide |
|---|---|
| PubChem CID | 111796057 |
| Molecular Formula | C17H29IN4O3 |
| Molecular Weight | 464.35 g/mol |
| Exact Mass | 464.13 |
| IUPAC Name | ethyl 4-[[N-[(2,5-dimethylfuran-3-yl)methyl]-N'-methylcarbamimidoyl]amino]piperidine-1-carboxylate;hydroiodide |
| SMILES | CCOC(=O)N1CCC(N/C(=N/C)NCc2cc(C)oc2C)CC1.I |
| InChI | InChI=1S/C17H28N4O3.HI/c1-5-23-17(22)21-8-6-15(7-9-21)20-16(18-4)19-11-14-10-12(2)24-13(14)3;/h10,15H,5-9,11H2,1-4H3,(H2,18,19,20);1H |
| InChIKey | OWWQDCZWHMXWKL-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 79.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.35 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|