C15H24BrIN4O2S — CID 111327873
ethyl 4-[[N-[(5-bromothiophen-2-yl)methyl]-N'-methylcarbamimidoyl]amino]piperidine-1-carboxylate;hydroiodide (PubChem CID 111327873) has the molecular formula C15H24BrIN4O2S and a molecular weight of 531.26 g/mol. Its IUPAC name is ethyl 4-[[N-[(5-bromothiophen-2-yl)methyl]-N'-methylcarbamimidoyl]amino]piperidine-1-carboxylate;hydroiodide.
| Compound Name | ethyl 4-[[N-[(5-bromothiophen-2-yl)methyl]-N'-methylcarbamimidoyl]amino]piperidine-1-carboxylate;hydroiodide |
|---|---|
| PubChem CID | 111327873 |
| Molecular Formula | C15H24BrIN4O2S |
| Molecular Weight | 531.26 g/mol |
| Exact Mass | 529.98 |
| IUPAC Name | ethyl 4-[[N-[(5-bromothiophen-2-yl)methyl]-N'-methylcarbamimidoyl]amino]piperidine-1-carboxylate;hydroiodide |
| SMILES | CCOC(=O)N1CCC(N/C(=N/C)NCc2ccc(Br)s2)CC1.I |
| InChI | InChI=1S/C15H23BrN4O2S.HI/c1-3-22-15(21)20-8-6-11(7-9-20)19-14(17-2)18-10-12-4-5-13(16)23-12;/h4-5,11H,3,6-10H2,1-2H3,(H2,17,18,19);1H |
| InChIKey | REAZVUASTYQKLJ-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.26 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|