C22H31N7O2 — CID 166185767
4-[2-(2,6-dimethylanilino)-2-oxoethyl]-N-(2-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl)piperazine-1-carboxamide (PubChem CID 166185767) has the molecular formula C22H31N7O2 and a molecular weight of 425.54 g/mol. Its IUPAC name is 4-[2-(2,6-dimethylanilino)-2-oxoethyl]-N-(2-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl)piperazine-1-carboxamide.
| Compound Name | 4-[2-(2,6-dimethylanilino)-2-oxoethyl]-N-(2-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 166185767 |
| Molecular Formula | C22H31N7O2 |
| Molecular Weight | 425.54 g/mol |
| Exact Mass | 425.25 |
| IUPAC Name | 4-[2-(2,6-dimethylanilino)-2-oxoethyl]-N-(2-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl)piperazine-1-carboxamide |
| SMILES | Cc1nc2n(n1)CC(NC(=O)N1CCN(CC(=O)Nc3c(C)cccc3C)CC1)CC2 |
| InChI | InChI=1S/C22H31N7O2/c1-15-5-4-6-16(2)21(15)25-20(30)14-27-9-11-28(12-10-27)22(31)24-18-7-8-19-23-17(3)26-29(19)13-18/h4-6,18H,7-14H2,1-3H3,(H,24,31)(H,25,30) |
| InChIKey | BAZAIKVUXKDWCT-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 95.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.54 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |