About 1-methyl-N-[(5-methyl-1,2-oxazol-3-yl)methyl]piperidin-4-amine
1-methyl-N-[(5-methyl-1,2-oxazol-3-yl)methyl]piperidin-4-amine (PubChem CID 60694528) has the molecular formula C11H19N3O
and a molecular weight of 209.29 g/mol. Its IUPAC name is 1-methyl-N-[(5-methyl-1,2-oxazol-3-yl)methyl]piperidin-4-amine.
Molecular Properties
| Compound Name | 1-methyl-N-[(5-methyl-1,2-oxazol-3-yl)methyl]piperidin-4-amine |
| PubChem CID | 60694528 |
| Molecular Formula | C11H19N3O |
| Molecular Weight | 209.29 g/mol |
| Exact Mass | 209.15 |
| IUPAC Name | 1-methyl-N-[(5-methyl-1,2-oxazol-3-yl)methyl]piperidin-4-amine |
| SMILES | Cc1cc(CNC2CCN(C)CC2)no1 |
| InChI | InChI=1S/C11H19N3O/c1-9-7-11(13-15-9)8-12-10-3-5-14(2)6-4-10/h7,10,12H,3-6,8H2,1-2H3 |
| InChIKey | XPDKKUQDAPPPRG-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 41.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.29 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-methyl-N-[(5-methyl-1,2-oxazol-3-yl)methyl]piperidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-N-[(5-methyl-1,2-oxazol-3-yl)methyl]piperidin-4-amine?
The IUPAC name of 1-methyl-N-[(5-methyl-1,2-oxazol-3-yl)methyl]piperidin-4-amine (CID 60694528) is 1-methyl-N-[(5-methyl-1,2-oxazol-3-yl)methyl]piperidin-4-amine.
What is the SMILES notation for 1-methyl-N-[(5-methyl-1,2-oxazol-3-yl)methyl]piperidin-4-amine?
The canonical SMILES for 1-methyl-N-[(5-methyl-1,2-oxazol-3-yl)methyl]piperidin-4-amine is Cc1cc(CNC2CCN(C)CC2)no1.
What is the InChIKey of 1-methyl-N-[(5-methyl-1,2-oxazol-3-yl)methyl]piperidin-4-amine?
The InChIKey is XPDKKUQDAPPPRG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19N3O/c1-9-7-11(13-15-9)8-12-10-3-5-14(2)6-4-10/h7,10,12H,3-6,8H2,1-2H3.
What are the key properties of 1-methyl-N-[(5-methyl-1,2-oxazol-3-yl)methyl]piperidin-4-amine?
1-methyl-N-[(5-methyl-1,2-oxazol-3-yl)methyl]piperidin-4-amine has a molecular weight of 209.29 g/mol, XLogP of 1.17, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-N-[(5-methyl-1,2-oxazol-3-yl)methyl]piperidin-4-amine is sourced from PubChem (CID 60694528), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).