C16H20N6OS — CID 56780063
2-propan-2-yl-N-[(3-thiophen-3-yl-1,2,4-oxadiazol-5-yl)methyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-amine (PubChem CID 56780063) has the molecular formula C16H20N6OS and a molecular weight of 344.44 g/mol. Its IUPAC name is 2-propan-2-yl-N-[(3-thiophen-3-yl-1,2,4-oxadiazol-5-yl)methyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-amine.
| Compound Name | 2-propan-2-yl-N-[(3-thiophen-3-yl-1,2,4-oxadiazol-5-yl)methyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-amine |
|---|---|
| PubChem CID | 56780063 |
| Molecular Formula | C16H20N6OS |
| Molecular Weight | 344.44 g/mol |
| Exact Mass | 344.14 |
| IUPAC Name | 2-propan-2-yl-N-[(3-thiophen-3-yl-1,2,4-oxadiazol-5-yl)methyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-amine |
| SMILES | CC(C)c1nc2n(n1)CC(NCc1nc(-c3ccsc3)no1)CC2 |
| InChI | InChI=1S/C16H20N6OS/c1-10(2)15-18-13-4-3-12(8-22(13)20-15)17-7-14-19-16(21-23-14)11-5-6-24-9-11/h5-6,9-10,12,17H,3-4,7-8H2,1-2H3 |
| InChIKey | PIDHKLRKNRUHKH-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 81.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.44 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |