C11H17N3O4S2 — CID 63922804
N-(1,1-dioxothian-3-yl)-2-(methylamino)pyridine-3-sulfonamide (PubChem CID 63922804) has the molecular formula C11H17N3O4S2 and a molecular weight of 319.41 g/mol. Its IUPAC name is N-(1,1-dioxothian-3-yl)-2-(methylamino)pyridine-3-sulfonamide.
| Compound Name | N-(1,1-dioxothian-3-yl)-2-(methylamino)pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 63922804 |
| Molecular Formula | C11H17N3O4S2 |
| Molecular Weight | 319.41 g/mol |
| Exact Mass | 319.07 |
| IUPAC Name | N-(1,1-dioxothian-3-yl)-2-(methylamino)pyridine-3-sulfonamide |
| SMILES | CNc1ncccc1S(=O)(=O)NC1CCCS(=O)(=O)C1 |
| InChI | InChI=1S/C11H17N3O4S2/c1-12-11-10(5-2-6-13-11)20(17,18)14-9-4-3-7-19(15,16)8-9/h2,5-6,9,14H,3-4,7-8H2,1H3,(H,12,13) |
| InChIKey | FDCSQFOKCXVIFR-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 105.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.41 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |