C13H20N2O4S2 — CID 63924074
5-amino-N-(1,1-dioxothian-3-yl)-2-ethylbenzenesulfonamide (PubChem CID 63924074) has the molecular formula C13H20N2O4S2 and a molecular weight of 332.45 g/mol. Its IUPAC name is 5-amino-N-(1,1-dioxothian-3-yl)-2-ethylbenzenesulfonamide.
| Compound Name | 5-amino-N-(1,1-dioxothian-3-yl)-2-ethylbenzenesulfonamide |
|---|---|
| PubChem CID | 63924074 |
| Molecular Formula | C13H20N2O4S2 |
| Molecular Weight | 332.45 g/mol |
| Exact Mass | 332.09 |
| IUPAC Name | 5-amino-N-(1,1-dioxothian-3-yl)-2-ethylbenzenesulfonamide |
| SMILES | CCc1ccc(N)cc1S(=O)(=O)NC1CCCS(=O)(=O)C1 |
| InChI | InChI=1S/C13H20N2O4S2/c1-2-10-5-6-11(14)8-13(10)21(18,19)15-12-4-3-7-20(16,17)9-12/h5-6,8,12,15H,2-4,7,9,14H2,1H3 |
| InChIKey | YGOYOYQWGPFAIW-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 106.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.45 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|