C12H16BrNO4S2 — CID 63923380
5-bromo-N-(1,1-dioxothian-3-yl)-2-methylbenzenesulfonamide (PubChem CID 63923380) has the molecular formula C12H16BrNO4S2 and a molecular weight of 382.30 g/mol. Its IUPAC name is 5-bromo-N-(1,1-dioxothian-3-yl)-2-methylbenzenesulfonamide.
| Compound Name | 5-bromo-N-(1,1-dioxothian-3-yl)-2-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 63923380 |
| Molecular Formula | C12H16BrNO4S2 |
| Molecular Weight | 382.30 g/mol |
| Exact Mass | 380.97 |
| IUPAC Name | 5-bromo-N-(1,1-dioxothian-3-yl)-2-methylbenzenesulfonamide |
| SMILES | Cc1ccc(Br)cc1S(=O)(=O)NC1CCCS(=O)(=O)C1 |
| InChI | InChI=1S/C12H16BrNO4S2/c1-9-4-5-10(13)7-12(9)20(17,18)14-11-3-2-6-19(15,16)8-11/h4-5,7,11,14H,2-3,6,8H2,1H3 |
| InChIKey | JKHHXCHKKVTQQQ-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.30 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |