C11H14BrClN2O4S2 — CID 63922300
3-amino-2-bromo-5-chloro-N-(1,1-dioxothian-3-yl)benzenesulfonamide (PubChem CID 63922300) has the molecular formula C11H14BrClN2O4S2 and a molecular weight of 417.73 g/mol. Its IUPAC name is 3-amino-2-bromo-5-chloro-N-(1,1-dioxothian-3-yl)benzenesulfonamide.
| Compound Name | 3-amino-2-bromo-5-chloro-N-(1,1-dioxothian-3-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 63922300 |
| Molecular Formula | C11H14BrClN2O4S2 |
| Molecular Weight | 417.73 g/mol |
| Exact Mass | 415.93 |
| IUPAC Name | 3-amino-2-bromo-5-chloro-N-(1,1-dioxothian-3-yl)benzenesulfonamide |
| SMILES | Nc1cc(Cl)cc(S(=O)(=O)NC2CCCS(=O)(=O)C2)c1Br |
| InChI | InChI=1S/C11H14BrClN2O4S2/c12-11-9(14)4-7(13)5-10(11)21(18,19)15-8-2-1-3-20(16,17)6-8/h4-5,8,15H,1-3,6,14H2 |
| InChIKey | BZRDYCOXBXSMEY-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 106.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.73 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|