C13H20N2O4S2 — CID 63922894
3-amino-N-(1,1-dioxothian-3-yl)-4,5-dimethylbenzenesulfonamide (PubChem CID 63922894) has the molecular formula C13H20N2O4S2 and a molecular weight of 332.45 g/mol. Its IUPAC name is 3-amino-N-(1,1-dioxothian-3-yl)-4,5-dimethylbenzenesulfonamide.
| Compound Name | 3-amino-N-(1,1-dioxothian-3-yl)-4,5-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 63922894 |
| Molecular Formula | C13H20N2O4S2 |
| Molecular Weight | 332.45 g/mol |
| Exact Mass | 332.09 |
| IUPAC Name | 3-amino-N-(1,1-dioxothian-3-yl)-4,5-dimethylbenzenesulfonamide |
| SMILES | Cc1cc(S(=O)(=O)NC2CCCS(=O)(=O)C2)cc(N)c1C |
| InChI | InChI=1S/C13H20N2O4S2/c1-9-6-12(7-13(14)10(9)2)21(18,19)15-11-4-3-5-20(16,17)8-11/h6-7,11,15H,3-5,8,14H2,1-2H3 |
| InChIKey | DPLOTYJZJBDJLC-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 106.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.45 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|