C15H24N2O2S — CID 79351747
3-amino-4,5-dimethyl-N-(2,2,3,3-tetramethylcyclopropyl)benzenesulfonamide (PubChem CID 79351747) has the molecular formula C15H24N2O2S and a molecular weight of 296.44 g/mol. Its IUPAC name is 3-amino-4,5-dimethyl-N-(2,2,3,3-tetramethylcyclopropyl)benzenesulfonamide.
| Compound Name | 3-amino-4,5-dimethyl-N-(2,2,3,3-tetramethylcyclopropyl)benzenesulfonamide |
|---|---|
| PubChem CID | 79351747 |
| Molecular Formula | C15H24N2O2S |
| Molecular Weight | 296.44 g/mol |
| Exact Mass | 296.16 |
| IUPAC Name | 3-amino-4,5-dimethyl-N-(2,2,3,3-tetramethylcyclopropyl)benzenesulfonamide |
| SMILES | Cc1cc(S(=O)(=O)NC2C(C)(C)C2(C)C)cc(N)c1C |
| InChI | InChI=1S/C15H24N2O2S/c1-9-7-11(8-12(16)10(9)2)20(18,19)17-13-14(3,4)15(13,5)6/h7-8,13,17H,16H2,1-6H3 |
| InChIKey | VSQDZQVDGWDTLG-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.44 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|