C14H15ClN2O2S — CID 29276916
3-amino-N-(4-chlorophenyl)-4,5-dimethylbenzenesulfonamide (PubChem CID 29276916) has the molecular formula C14H15ClN2O2S and a molecular weight of 310.81 g/mol. Its IUPAC name is 3-amino-N-(4-chlorophenyl)-4,5-dimethylbenzenesulfonamide.
| Compound Name | 3-amino-N-(4-chlorophenyl)-4,5-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 29276916 |
| Molecular Formula | C14H15ClN2O2S |
| Molecular Weight | 310.81 g/mol |
| Exact Mass | 310.05 |
| IUPAC Name | 3-amino-N-(4-chlorophenyl)-4,5-dimethylbenzenesulfonamide |
| SMILES | Cc1cc(S(=O)(=O)Nc2ccc(Cl)cc2)cc(N)c1C |
| InChI | InChI=1S/C14H15ClN2O2S/c1-9-7-13(8-14(16)10(9)2)20(18,19)17-12-5-3-11(15)4-6-12/h3-8,17H,16H2,1-2H3 |
| InChIKey | XFKRNPCOTQNCMZ-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.81 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|