C12H17FN2O2S — CID 116791780
3-amino-N-(2,2-dimethylcyclopropyl)-5-fluoro-4-methylbenzenesulfonamide (PubChem CID 116791780) has the molecular formula C12H17FN2O2S and a molecular weight of 272.35 g/mol. Its IUPAC name is 3-amino-N-(2,2-dimethylcyclopropyl)-5-fluoro-4-methylbenzenesulfonamide.
| Compound Name | 3-amino-N-(2,2-dimethylcyclopropyl)-5-fluoro-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 116791780 |
| Molecular Formula | C12H17FN2O2S |
| Molecular Weight | 272.35 g/mol |
| Exact Mass | 272.10 |
| IUPAC Name | 3-amino-N-(2,2-dimethylcyclopropyl)-5-fluoro-4-methylbenzenesulfonamide |
| SMILES | Cc1c(N)cc(S(=O)(=O)NC2CC2(C)C)cc1F |
| InChI | InChI=1S/C12H17FN2O2S/c1-7-9(13)4-8(5-10(7)14)18(16,17)15-11-6-12(11,2)3/h4-5,11,15H,6,14H2,1-3H3 |
| InChIKey | LFHZBYVJEHUUQP-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.35 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|