C14H22N2O3S — CID 107213608
5-amino-2-ethyl-N-[(1R,2R)-2-hydroxycyclohexyl]benzenesulfonamide (PubChem CID 107213608) has the molecular formula C14H22N2O3S and a molecular weight of 298.41 g/mol. Its IUPAC name is 5-amino-2-ethyl-N-[(1R,2R)-2-hydroxycyclohexyl]benzenesulfonamide.
| Compound Name | 5-amino-2-ethyl-N-[(1R,2R)-2-hydroxycyclohexyl]benzenesulfonamide |
|---|---|
| PubChem CID | 107213608 |
| Molecular Formula | C14H22N2O3S |
| Molecular Weight | 298.41 g/mol |
| Exact Mass | 298.14 |
| IUPAC Name | 5-amino-2-ethyl-N-[(1R,2R)-2-hydroxycyclohexyl]benzenesulfonamide |
| SMILES | CCc1ccc(N)cc1S(=O)(=O)N[C@@H]1CCCC[C@H]1O |
| InChI | InChI=1S/C14H22N2O3S/c1-2-10-7-8-11(15)9-14(10)20(18,19)16-12-5-3-4-6-13(12)17/h7-9,12-13,16-17H,2-6,15H2,1H3/t12-,13-/m1/s1 |
| InChIKey | FTABNFDIYPRSJX-CHWSQXEVSA-N |
| XLogP | 1.41 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.41 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|