C10H15N3O4S2 — CID 62146133
2-amino-N-(1,1-dioxothian-4-yl)pyridine-3-sulfonamide (PubChem CID 62146133) has the molecular formula C10H15N3O4S2 and a molecular weight of 305.38 g/mol. Its IUPAC name is 2-amino-N-(1,1-dioxothian-4-yl)pyridine-3-sulfonamide.
| Compound Name | 2-amino-N-(1,1-dioxothian-4-yl)pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 62146133 |
| Molecular Formula | C10H15N3O4S2 |
| Molecular Weight | 305.38 g/mol |
| Exact Mass | 305.05 |
| IUPAC Name | 2-amino-N-(1,1-dioxothian-4-yl)pyridine-3-sulfonamide |
| SMILES | Nc1ncccc1S(=O)(=O)NC1CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C10H15N3O4S2/c11-10-9(2-1-5-12-10)19(16,17)13-8-3-6-18(14,15)7-4-8/h1-2,5,8,13H,3-4,6-7H2,(H2,11,12) |
| InChIKey | YYWPBEAPOAEOGR-UHFFFAOYSA-N |
| XLogP | -0.48 |
| TPSA | 119.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.38 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |