C10H15N3O4S2 — CID 43454796
N-(1,1-dioxothiolan-3-yl)-2-hydrazinylbenzenesulfonamide (PubChem CID 43454796) has the molecular formula C10H15N3O4S2 and a molecular weight of 305.38 g/mol. Its IUPAC name is N-(1,1-dioxothiolan-3-yl)-2-hydrazinylbenzenesulfonamide.
| Compound Name | N-(1,1-dioxothiolan-3-yl)-2-hydrazinylbenzenesulfonamide |
|---|---|
| PubChem CID | 43454796 |
| Molecular Formula | C10H15N3O4S2 |
| Molecular Weight | 305.38 g/mol |
| Exact Mass | 305.05 |
| IUPAC Name | N-(1,1-dioxothiolan-3-yl)-2-hydrazinylbenzenesulfonamide |
| SMILES | NNc1ccccc1S(=O)(=O)NC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C10H15N3O4S2/c11-12-9-3-1-2-4-10(9)19(16,17)13-8-5-6-18(14,15)7-8/h1-4,8,12-13H,5-7,11H2 |
| InChIKey | JILMKROMZOHXGE-UHFFFAOYSA-N |
| XLogP | -0.56 |
| TPSA | 118.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.38 |
| LogP ≤ 5 | -0.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|