C12H18N2O4S2 — CID 62162999
N-(1,1-dioxothiolan-3-yl)-2-(ethylamino)benzenesulfonamide (PubChem CID 62162999) has the molecular formula C12H18N2O4S2 and a molecular weight of 318.42 g/mol. Its IUPAC name is N-(1,1-dioxothiolan-3-yl)-2-(ethylamino)benzenesulfonamide.
| Compound Name | N-(1,1-dioxothiolan-3-yl)-2-(ethylamino)benzenesulfonamide |
|---|---|
| PubChem CID | 62162999 |
| Molecular Formula | C12H18N2O4S2 |
| Molecular Weight | 318.42 g/mol |
| Exact Mass | 318.07 |
| IUPAC Name | N-(1,1-dioxothiolan-3-yl)-2-(ethylamino)benzenesulfonamide |
| SMILES | CCNc1ccccc1S(=O)(=O)NC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C12H18N2O4S2/c1-2-13-11-5-3-4-6-12(11)20(17,18)14-10-7-8-19(15,16)9-10/h3-6,10,13-14H,2,7-9H2,1H3 |
| InChIKey | RVCANNQQFJIZNE-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.42 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |