C13H16N2O4S2 — CID 60845506
2-(3-aminoprop-1-ynyl)-N-(1,1-dioxothiolan-3-yl)benzenesulfonamide (PubChem CID 60845506) has the molecular formula C13H16N2O4S2 and a molecular weight of 328.42 g/mol. Its IUPAC name is 2-(3-aminoprop-1-ynyl)-N-(1,1-dioxothiolan-3-yl)benzenesulfonamide.
| Compound Name | 2-(3-aminoprop-1-ynyl)-N-(1,1-dioxothiolan-3-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 60845506 |
| Molecular Formula | C13H16N2O4S2 |
| Molecular Weight | 328.42 g/mol |
| Exact Mass | 328.06 |
| IUPAC Name | 2-(3-aminoprop-1-ynyl)-N-(1,1-dioxothiolan-3-yl)benzenesulfonamide |
| SMILES | NCC#Cc1ccccc1S(=O)(=O)NC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C13H16N2O4S2/c14-8-3-5-11-4-1-2-6-13(11)21(18,19)15-12-7-9-20(16,17)10-12/h1-2,4,6,12,15H,7-10,14H2 |
| InChIKey | MEAQSWGPMNINSD-UHFFFAOYSA-N |
| XLogP | -0.54 |
| TPSA | 106.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.42 |
| LogP ≤ 5 | -0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|