C10H11N3O5S2 — CID 7189339
N-[(3S)-1,1-dioxothiolan-3-yl]-2,1,3-benzoxadiazole-4-sulfonamide (PubChem CID 7189339) has the molecular formula C10H11N3O5S2 and a molecular weight of 317.35 g/mol. Its IUPAC name is N-[(3S)-1,1-dioxothiolan-3-yl]-2,1,3-benzoxadiazole-4-sulfonamide.
| Compound Name | N-[(3S)-1,1-dioxothiolan-3-yl]-2,1,3-benzoxadiazole-4-sulfonamide |
|---|---|
| PubChem CID | 7189339 |
| Molecular Formula | C10H11N3O5S2 |
| Molecular Weight | 317.35 g/mol |
| Exact Mass | 317.01 |
| IUPAC Name | N-[(3S)-1,1-dioxothiolan-3-yl]-2,1,3-benzoxadiazole-4-sulfonamide |
| SMILES | O=S1(=O)CC[C@H](NS(=O)(=O)c2cccc3nonc23)C1 |
| InChI | InChI=1S/C10H11N3O5S2/c14-19(15)5-4-7(6-19)13-20(16,17)9-3-1-2-8-10(9)12-18-11-8/h1-3,7,13H,4-6H2/t7-/m0/s1 |
| InChIKey | CVKDLNKBAIEPJQ-ZETCQYMHSA-N |
| XLogP | -0.31 |
| TPSA | 119.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.35 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |