C12H9N3O3S — CID 6467616
N-phenyl-2,1,3-benzoxadiazole-4-sulfonamide (PubChem CID 6467616) has the molecular formula C12H9N3O3S and a molecular weight of 275.29 g/mol. Its IUPAC name is N-phenyl-2,1,3-benzoxadiazole-4-sulfonamide.
| Compound Name | N-phenyl-2,1,3-benzoxadiazole-4-sulfonamide |
|---|---|
| PubChem CID | 6467616 |
| Molecular Formula | C12H9N3O3S |
| Molecular Weight | 275.29 g/mol |
| Exact Mass | 275.04 |
| IUPAC Name | N-phenyl-2,1,3-benzoxadiazole-4-sulfonamide |
| SMILES | O=S(=O)(Nc1ccccc1)c1cccc2nonc12 |
| InChI | InChI=1S/C12H9N3O3S/c16-19(17,15-9-5-2-1-3-6-9)11-8-4-7-10-12(11)14-18-13-10/h1-8,15H |
| InChIKey | JSKQJULRQVVHSS-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 85.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.29 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diazox_sulfon_A(36)', 'substructure': 'N/A'} |
|---|