C18H17N5O3S — CID 17374551
N-[4-[(3,5-dimethylpyrazol-1-yl)methyl]phenyl]-2,1,3-benzoxadiazole-4-sulfonamide (PubChem CID 17374551) has the molecular formula C18H17N5O3S and a molecular weight of 383.43 g/mol. Its IUPAC name is N-[4-[(3,5-dimethylpyrazol-1-yl)methyl]phenyl]-2,1,3-benzoxadiazole-4-sulfonamide.
| Compound Name | N-[4-[(3,5-dimethylpyrazol-1-yl)methyl]phenyl]-2,1,3-benzoxadiazole-4-sulfonamide |
|---|---|
| PubChem CID | 17374551 |
| Molecular Formula | C18H17N5O3S |
| Molecular Weight | 383.43 g/mol |
| Exact Mass | 383.11 |
| IUPAC Name | N-[4-[(3,5-dimethylpyrazol-1-yl)methyl]phenyl]-2,1,3-benzoxadiazole-4-sulfonamide |
| SMILES | Cc1cc(C)n(Cc2ccc(NS(=O)(=O)c3cccc4nonc34)cc2)n1 |
| InChI | InChI=1S/C18H17N5O3S/c1-12-10-13(2)23(19-12)11-14-6-8-15(9-7-14)22-27(24,25)17-5-3-4-16-18(17)21-26-20-16/h3-10,22H,11H2,1-2H3 |
| InChIKey | JQBDSXVJZXYUOB-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 102.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.43 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diazox_sulfon_A(36)', 'substructure': 'N/A'} |
|---|