C13H11N3O4S — CID 4092014
N-(4-methoxyphenyl)-2,1,3-benzoxadiazole-4-sulfonamide (PubChem CID 4092014) has the molecular formula C13H11N3O4S and a molecular weight of 305.32 g/mol. Its IUPAC name is N-(4-methoxyphenyl)-2,1,3-benzoxadiazole-4-sulfonamide.
| Compound Name | N-(4-methoxyphenyl)-2,1,3-benzoxadiazole-4-sulfonamide |
|---|---|
| PubChem CID | 4092014 |
| Molecular Formula | C13H11N3O4S |
| Molecular Weight | 305.32 g/mol |
| Exact Mass | 305.05 |
| IUPAC Name | N-(4-methoxyphenyl)-2,1,3-benzoxadiazole-4-sulfonamide |
| SMILES | COc1ccc(NS(=O)(=O)c2cccc3nonc23)cc1 |
| InChI | InChI=1S/C13H11N3O4S/c1-19-10-7-5-9(6-8-10)16-21(17,18)12-4-2-3-11-13(12)15-20-14-11/h2-8,16H,1H3 |
| InChIKey | NFDXZOWSHXPFCF-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 94.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.32 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diazox_sulfon_A(36)', 'substructure': 'N/A'} |
|---|