C12H8FN3O3S — CID 3265280
N-(2-fluorophenyl)-2,1,3-benzoxadiazole-4-sulfonamide (PubChem CID 3265280) has the molecular formula C12H8FN3O3S and a molecular weight of 293.28 g/mol. Its IUPAC name is N-(2-fluorophenyl)-2,1,3-benzoxadiazole-4-sulfonamide.
| Compound Name | N-(2-fluorophenyl)-2,1,3-benzoxadiazole-4-sulfonamide |
|---|---|
| PubChem CID | 3265280 |
| Molecular Formula | C12H8FN3O3S |
| Molecular Weight | 293.28 g/mol |
| Exact Mass | 293.03 |
| IUPAC Name | N-(2-fluorophenyl)-2,1,3-benzoxadiazole-4-sulfonamide |
| SMILES | O=S(=O)(Nc1ccccc1F)c1cccc2nonc12 |
| InChI | InChI=1S/C12H8FN3O3S/c13-8-4-1-2-5-9(8)16-20(17,18)11-7-3-6-10-12(11)15-19-14-10/h1-7,16H |
| InChIKey | MNYJQUORQUVOSX-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 85.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.28 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diazox_sulfon_A(36)', 'substructure': 'N/A'} |
|---|