C13H7ClF3N3O3S — CID 22201410
N-[4-chloro-2-(trifluoromethyl)phenyl]-2,1,3-benzoxadiazole-4-sulfonamide (PubChem CID 22201410) has the molecular formula C13H7ClF3N3O3S and a molecular weight of 377.73 g/mol. Its IUPAC name is N-[4-chloro-2-(trifluoromethyl)phenyl]-2,1,3-benzoxadiazole-4-sulfonamide.
| Compound Name | N-[4-chloro-2-(trifluoromethyl)phenyl]-2,1,3-benzoxadiazole-4-sulfonamide |
|---|---|
| PubChem CID | 22201410 |
| Molecular Formula | C13H7ClF3N3O3S |
| Molecular Weight | 377.73 g/mol |
| Exact Mass | 376.98 |
| IUPAC Name | N-[4-chloro-2-(trifluoromethyl)phenyl]-2,1,3-benzoxadiazole-4-sulfonamide |
| SMILES | O=S(=O)(Nc1ccc(Cl)cc1C(F)(F)F)c1cccc2nonc12 |
| InChI | InChI=1S/C13H7ClF3N3O3S/c14-7-4-5-9(8(6-7)13(15,16)17)20-24(21,22)11-3-1-2-10-12(11)19-23-18-10/h1-6,20H |
| InChIKey | QYWFPMSIYRHUAX-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 85.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.73 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diazox_sulfon_A(36)', 'substructure': 'N/A'} |
|---|