C14H12ClN3O3S — CID 39818916
N-[(1R)-1-(4-chlorophenyl)ethyl]-2,1,3-benzoxadiazole-4-sulfonamide (PubChem CID 39818916) has the molecular formula C14H12ClN3O3S and a molecular weight of 337.79 g/mol. Its IUPAC name is N-[(1R)-1-(4-chlorophenyl)ethyl]-2,1,3-benzoxadiazole-4-sulfonamide.
| Compound Name | N-[(1R)-1-(4-chlorophenyl)ethyl]-2,1,3-benzoxadiazole-4-sulfonamide |
|---|---|
| PubChem CID | 39818916 |
| Molecular Formula | C14H12ClN3O3S |
| Molecular Weight | 337.79 g/mol |
| Exact Mass | 337.03 |
| IUPAC Name | N-[(1R)-1-(4-chlorophenyl)ethyl]-2,1,3-benzoxadiazole-4-sulfonamide |
| SMILES | C[C@@H](NS(=O)(=O)c1cccc2nonc12)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C14H12ClN3O3S/c1-9(10-5-7-11(15)8-6-10)18-22(19,20)13-4-2-3-12-14(13)17-21-16-12/h2-9,18H,1H3/t9-/m1/s1 |
| InChIKey | NTLJYAYCPBPFDU-SECBINFHSA-N |
| XLogP | 2.92 |
| TPSA | 85.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.79 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |