C17H19N3O3S — CID 22204686
N-[1-(4-propylphenyl)ethyl]-2,1,3-benzoxadiazole-4-sulfonamide (PubChem CID 22204686) has the molecular formula C17H19N3O3S and a molecular weight of 345.42 g/mol. Its IUPAC name is N-[1-(4-propylphenyl)ethyl]-2,1,3-benzoxadiazole-4-sulfonamide.
| Compound Name | N-[1-(4-propylphenyl)ethyl]-2,1,3-benzoxadiazole-4-sulfonamide |
|---|---|
| PubChem CID | 22204686 |
| Molecular Formula | C17H19N3O3S |
| Molecular Weight | 345.42 g/mol |
| Exact Mass | 345.11 |
| IUPAC Name | N-[1-(4-propylphenyl)ethyl]-2,1,3-benzoxadiazole-4-sulfonamide |
| SMILES | CCCc1ccc(C(C)NS(=O)(=O)c2cccc3nonc23)cc1 |
| InChI | InChI=1S/C17H19N3O3S/c1-3-5-13-8-10-14(11-9-13)12(2)20-24(21,22)16-7-4-6-15-17(16)19-23-18-15/h4,6-12,20H,3,5H2,1-2H3 |
| InChIKey | AOUQTIYEXKKAQE-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 85.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.42 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |