C13H10BrN3O3S — CID 22774651
N-(4-bromo-2-methylphenyl)-2,1,3-benzoxadiazole-4-sulfonamide (PubChem CID 22774651) has the molecular formula C13H10BrN3O3S and a molecular weight of 368.21 g/mol. Its IUPAC name is N-(4-bromo-2-methylphenyl)-2,1,3-benzoxadiazole-4-sulfonamide.
| Compound Name | N-(4-bromo-2-methylphenyl)-2,1,3-benzoxadiazole-4-sulfonamide |
|---|---|
| PubChem CID | 22774651 |
| Molecular Formula | C13H10BrN3O3S |
| Molecular Weight | 368.21 g/mol |
| Exact Mass | 366.96 |
| IUPAC Name | N-(4-bromo-2-methylphenyl)-2,1,3-benzoxadiazole-4-sulfonamide |
| SMILES | Cc1cc(Br)ccc1NS(=O)(=O)c1cccc2nonc12 |
| InChI | InChI=1S/C13H10BrN3O3S/c1-8-7-9(14)5-6-10(8)17-21(18,19)12-4-2-3-11-13(12)16-20-15-11/h2-7,17H,1H3 |
| InChIKey | DECQNWMFJIQJEX-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 85.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.21 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diazox_sulfon_A(36)', 'substructure': 'N/A'} |
|---|