C11H9ClF3N3O2S — CID 60911752
N-[4-chloro-2-(trifluoromethyl)phenyl]-5-methyl-1H-pyrazole-4-sulfonamide (PubChem CID 60911752) has the molecular formula C11H9ClF3N3O2S and a molecular weight of 339.73 g/mol. Its IUPAC name is N-[4-chloro-2-(trifluoromethyl)phenyl]-5-methyl-1H-pyrazole-4-sulfonamide.
| Compound Name | N-[4-chloro-2-(trifluoromethyl)phenyl]-5-methyl-1H-pyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 60911752 |
| Molecular Formula | C11H9ClF3N3O2S |
| Molecular Weight | 339.73 g/mol |
| Exact Mass | 339.01 |
| IUPAC Name | N-[4-chloro-2-(trifluoromethyl)phenyl]-5-methyl-1H-pyrazole-4-sulfonamide |
| SMILES | Cc1[nH]ncc1S(=O)(=O)Nc1ccc(Cl)cc1C(F)(F)F |
| InChI | InChI=1S/C11H9ClF3N3O2S/c1-6-10(5-16-17-6)21(19,20)18-9-3-2-7(12)4-8(9)11(13,14)15/h2-5,18H,1H3,(H,16,17) |
| InChIKey | VOVNZLMHHQLQNS-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.73 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |