About N-(2-amino-2-phenylethyl)-2,1,3-benzoxadiazole-4-sulfonamide;hydrochloride
N-(2-amino-2-phenylethyl)-2,1,3-benzoxadiazole-4-sulfonamide;hydrochloride (PubChem CID 84591138) has the molecular formula C14H15ClN4O3S
and a molecular weight of 354.82 g/mol. Its IUPAC name is N-(2-amino-2-phenylethyl)-2,1,3-benzoxadiazole-4-sulfonamide;hydrochloride.
Molecular Properties
| Compound Name | N-(2-amino-2-phenylethyl)-2,1,3-benzoxadiazole-4-sulfonamide;hydrochloride |
| PubChem CID | 84591138 |
| Molecular Formula | C14H15ClN4O3S |
| Molecular Weight | 354.82 g/mol |
| Exact Mass | 354.06 |
| IUPAC Name | N-(2-amino-2-phenylethyl)-2,1,3-benzoxadiazole-4-sulfonamide;hydrochloride |
| SMILES | Cl.NC(CNS(=O)(=O)c1cccc2nonc12)c1ccccc1 |
| InChI | InChI=1S/C14H14N4O3S.ClH/c15-11(10-5-2-1-3-6-10)9-16-22(19,20)13-8-4-7-12-14(13)18-21-17-12;/h1-8,11,16H,9,15H2;1H |
| InChIKey | GOABLWYSQDUREJ-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 111.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 354.82 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-(2-amino-2-phenylethyl)-2,1,3-benzoxadiazole-4-sulfonamide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-amino-2-phenylethyl)-2,1,3-benzoxadiazole-4-sulfonamide;hydrochloride?
The IUPAC name of N-(2-amino-2-phenylethyl)-2,1,3-benzoxadiazole-4-sulfonamide;hydrochloride (CID 84591138) is N-(2-amino-2-phenylethyl)-2,1,3-benzoxadiazole-4-sulfonamide;hydrochloride.
What is the SMILES notation for N-(2-amino-2-phenylethyl)-2,1,3-benzoxadiazole-4-sulfonamide;hydrochloride?
The canonical SMILES for N-(2-amino-2-phenylethyl)-2,1,3-benzoxadiazole-4-sulfonamide;hydrochloride is Cl.NC(CNS(=O)(=O)c1cccc2nonc12)c1ccccc1.
What is the InChIKey of N-(2-amino-2-phenylethyl)-2,1,3-benzoxadiazole-4-sulfonamide;hydrochloride?
The InChIKey is GOABLWYSQDUREJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14N4O3S.ClH/c15-11(10-5-2-1-3-6-10)9-16-22(19,20)13-8-4-7-12-14(13)18-21-17-12;/h1-8,11,16H,9,15H2;1H.
What are the key properties of N-(2-amino-2-phenylethyl)-2,1,3-benzoxadiazole-4-sulfonamide;hydrochloride?
N-(2-amino-2-phenylethyl)-2,1,3-benzoxadiazole-4-sulfonamide;hydrochloride has a molecular weight of 354.82 g/mol, XLogP of 1.62, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-amino-2-phenylethyl)-2,1,3-benzoxadiazole-4-sulfonamide;hydrochloride is sourced from PubChem (CID 84591138), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).