C16H21ClN2O2S — CID 119976287
N-(2-amino-2-phenylethyl)-2,5-dimethylbenzenesulfonamide;hydrochloride (PubChem CID 119976287) has the molecular formula C16H21ClN2O2S and a molecular weight of 340.88 g/mol. Its IUPAC name is N-(2-amino-2-phenylethyl)-2,5-dimethylbenzenesulfonamide;hydrochloride.
| Compound Name | N-(2-amino-2-phenylethyl)-2,5-dimethylbenzenesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 119976287 |
| Molecular Formula | C16H21ClN2O2S |
| Molecular Weight | 340.88 g/mol |
| Exact Mass | 340.10 |
| IUPAC Name | N-(2-amino-2-phenylethyl)-2,5-dimethylbenzenesulfonamide;hydrochloride |
| SMILES | Cc1ccc(C)c(S(=O)(=O)NCC(N)c2ccccc2)c1.Cl |
| InChI | InChI=1S/C16H20N2O2S.ClH/c1-12-8-9-13(2)16(10-12)21(19,20)18-11-15(17)14-6-4-3-5-7-14;/h3-10,15,18H,11,17H2,1-2H3;1H |
| InChIKey | FEQGJPVGAKXFNY-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.88 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |