C14H17Cl2N3O2S — CID 84591500
N-(2-amino-2-phenylethyl)-6-chloro-5-methylpyridine-3-sulfonamide;hydrochloride (PubChem CID 84591500) has the molecular formula C14H17Cl2N3O2S and a molecular weight of 362.28 g/mol. Its IUPAC name is N-(2-amino-2-phenylethyl)-6-chloro-5-methylpyridine-3-sulfonamide;hydrochloride.
| Compound Name | N-(2-amino-2-phenylethyl)-6-chloro-5-methylpyridine-3-sulfonamide;hydrochloride |
|---|---|
| PubChem CID | 84591500 |
| Molecular Formula | C14H17Cl2N3O2S |
| Molecular Weight | 362.28 g/mol |
| Exact Mass | 361.04 |
| IUPAC Name | N-(2-amino-2-phenylethyl)-6-chloro-5-methylpyridine-3-sulfonamide;hydrochloride |
| SMILES | Cc1cc(S(=O)(=O)NCC(N)c2ccccc2)cnc1Cl.Cl |
| InChI | InChI=1S/C14H16ClN3O2S.ClH/c1-10-7-12(8-17-14(10)15)21(19,20)18-9-13(16)11-5-3-2-4-6-11;/h2-8,13,18H,9,16H2,1H3;1H |
| InChIKey | XCUPLGIQJYBSHN-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.28 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|