C13H20N2O4S2 — CID 43454539
2-[(1,1-dioxothiolan-3-yl)amino]-N-propylbenzenesulfonamide (PubChem CID 43454539) has the molecular formula C13H20N2O4S2 and a molecular weight of 332.45 g/mol. Its IUPAC name is 2-[(1,1-dioxothiolan-3-yl)amino]-N-propylbenzenesulfonamide.
| Compound Name | 2-[(1,1-dioxothiolan-3-yl)amino]-N-propylbenzenesulfonamide |
|---|---|
| PubChem CID | 43454539 |
| Molecular Formula | C13H20N2O4S2 |
| Molecular Weight | 332.45 g/mol |
| Exact Mass | 332.09 |
| IUPAC Name | 2-[(1,1-dioxothiolan-3-yl)amino]-N-propylbenzenesulfonamide |
| SMILES | CCCNS(=O)(=O)c1ccccc1NC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C13H20N2O4S2/c1-2-8-14-21(18,19)13-6-4-3-5-12(13)15-11-7-9-20(16,17)10-11/h3-6,11,14-15H,2,7-10H2,1H3 |
| InChIKey | OFIQKJKYPYDHOK-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.45 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |