C13H20N2O3S — CID 80713071
2-(oxolan-3-ylamino)-N-propylbenzenesulfonamide (PubChem CID 80713071) has the molecular formula C13H20N2O3S and a molecular weight of 284.38 g/mol. Its IUPAC name is 2-(oxolan-3-ylamino)-N-propylbenzenesulfonamide.
| Compound Name | 2-(oxolan-3-ylamino)-N-propylbenzenesulfonamide |
|---|---|
| PubChem CID | 80713071 |
| Molecular Formula | C13H20N2O3S |
| Molecular Weight | 284.38 g/mol |
| Exact Mass | 284.12 |
| IUPAC Name | 2-(oxolan-3-ylamino)-N-propylbenzenesulfonamide |
| SMILES | CCCNS(=O)(=O)c1ccccc1NC1CCOC1 |
| InChI | InChI=1S/C13H20N2O3S/c1-2-8-14-19(16,17)13-6-4-3-5-12(13)15-11-7-9-18-10-11/h3-6,11,14-15H,2,7-10H2,1H3 |
| InChIKey | VVGSJYOCZYIOPG-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.38 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |