C18H16Cl2F3N3O — CID 11661679
2-chloro-N-[(1R,2R)-2-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]cyclohexyl]pyridine-3-carboxamide (PubChem CID 11661679) has the molecular formula C18H16Cl2F3N3O and a molecular weight of 418.25 g/mol. Its IUPAC name is 2-chloro-N-[(1R,2R)-2-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]cyclohexyl]pyridine-3-carboxamide.
| Compound Name | 2-chloro-N-[(1R,2R)-2-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]cyclohexyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 11661679 |
| Molecular Formula | C18H16Cl2F3N3O |
| Molecular Weight | 418.25 g/mol |
| Exact Mass | 417.06 |
| IUPAC Name | 2-chloro-N-[(1R,2R)-2-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]cyclohexyl]pyridine-3-carboxamide |
| SMILES | O=C(N[C@@H]1CCCC[C@H]1c1ncc(C(F)(F)F)cc1Cl)c1cccnc1Cl |
| InChI | InChI=1S/C18H16Cl2F3N3O/c19-13-8-10(18(21,22)23)9-25-15(13)11-4-1-2-6-14(11)26-17(27)12-5-3-7-24-16(12)20/h3,5,7-9,11,14H,1-2,4,6H2,(H,26,27)/t11-,14-/m1/s1 |
| InChIKey | YOXKECMKGWHKMN-BXUZGUMPSA-N |
| XLogP | 5.26 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.25 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|