C15H11BrClF3N4O — CID 171785720
2-bromo-N-[1-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]azetidin-3-yl]pyridine-3-carboxamide (PubChem CID 171785720) has the molecular formula C15H11BrClF3N4O and a molecular weight of 435.63 g/mol. Its IUPAC name is 2-bromo-N-[1-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]azetidin-3-yl]pyridine-3-carboxamide.
| Compound Name | 2-bromo-N-[1-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]azetidin-3-yl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 171785720 |
| Molecular Formula | C15H11BrClF3N4O |
| Molecular Weight | 435.63 g/mol |
| Exact Mass | 433.98 |
| IUPAC Name | 2-bromo-N-[1-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]azetidin-3-yl]pyridine-3-carboxamide |
| SMILES | O=C(NC1CN(c2ncc(C(F)(F)F)cc2Cl)C1)c1cccnc1Br |
| InChI | InChI=1S/C15H11BrClF3N4O/c16-12-10(2-1-3-21-12)14(25)23-9-6-24(7-9)13-11(17)4-8(5-22-13)15(18,19)20/h1-5,9H,6-7H2,(H,23,25) |
| InChIKey | CCEBHTLUOWMVSW-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.63 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|