C14H13ClF3N3O — CID 124733283
N-[(3S)-1-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]pyrrolidin-3-yl]but-2-ynamide (PubChem CID 124733283) has the molecular formula C14H13ClF3N3O and a molecular weight of 331.73 g/mol. Its IUPAC name is N-[(3S)-1-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]pyrrolidin-3-yl]but-2-ynamide.
| Compound Name | N-[(3S)-1-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]pyrrolidin-3-yl]but-2-ynamide |
|---|---|
| PubChem CID | 124733283 |
| Molecular Formula | C14H13ClF3N3O |
| Molecular Weight | 331.73 g/mol |
| Exact Mass | 331.07 |
| IUPAC Name | N-[(3S)-1-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]pyrrolidin-3-yl]but-2-ynamide |
| SMILES | CC#CC(=O)N[C@H]1CCN(c2ncc(C(F)(F)F)cc2Cl)C1 |
| InChI | InChI=1S/C14H13ClF3N3O/c1-2-3-12(22)20-10-4-5-21(8-10)13-11(15)6-9(7-19-13)14(16,17)18/h6-7,10H,4-5,8H2,1H3,(H,20,22)/t10-/m0/s1 |
| InChIKey | KRXSXTZKJATXRC-JTQLQIEISA-N |
| XLogP | 2.47 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.73 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|