C19H18F3NO — CID 144740074
2-methyl-N-[(1S,2S)-2-[2-(trifluoromethyl)phenyl]cyclobutyl]benzamide (PubChem CID 144740074) has the molecular formula C19H18F3NO and a molecular weight of 333.35 g/mol. Its IUPAC name is 2-methyl-N-[(1S,2S)-2-[2-(trifluoromethyl)phenyl]cyclobutyl]benzamide.
| Compound Name | 2-methyl-N-[(1S,2S)-2-[2-(trifluoromethyl)phenyl]cyclobutyl]benzamide |
|---|---|
| PubChem CID | 144740074 |
| Molecular Formula | C19H18F3NO |
| Molecular Weight | 333.35 g/mol |
| Exact Mass | 333.13 |
| IUPAC Name | 2-methyl-N-[(1S,2S)-2-[2-(trifluoromethyl)phenyl]cyclobutyl]benzamide |
| SMILES | Cc1ccccc1C(=O)N[C@H]1CC[C@H]1c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C19H18F3NO/c1-12-6-2-3-7-13(12)18(24)23-17-11-10-15(17)14-8-4-5-9-16(14)19(20,21)22/h2-9,15,17H,10-11H2,1H3,(H,23,24)/t15-,17-/m0/s1 |
| InChIKey | JSJGLXBHIUXTNB-RDJZCZTQSA-N |
| XLogP | 4.69 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.35 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |